About 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel
1-bromocyclohexa-3,5-diene-1,3-diamine;nickel (PubChem CID 87399379) has the molecular formula C6H9BrN2Ni
and a molecular weight of 247.75 g/mol. Its IUPAC name is 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel.
Molecular Properties
| Compound Name | 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel |
| PubChem CID | 87399379 |
| Molecular Formula | C6H9BrN2Ni |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 245.93 |
| IUPAC Name | 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel |
| SMILES | NC1=CC=CC(N)(Br)C1.[Ni] |
| InChI | InChI=1S/C6H9BrN2.Ni/c7-6(9)3-1-2-5(8)4-6;/h1-3H,4,8-9H2; |
| InChIKey | MKKAVFBNKCGXBW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel?
The IUPAC name of 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel (CID 87399379) is 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel.
What is the SMILES notation for 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel?
The canonical SMILES for 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel is NC1=CC=CC(N)(Br)C1.[Ni].
What is the InChIKey of 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel?
The InChIKey is MKKAVFBNKCGXBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN2.Ni/c7-6(9)3-1-2-5(8)4-6;/h1-3H,4,8-9H2;.
What are the key properties of 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel?
1-bromocyclohexa-3,5-diene-1,3-diamine;nickel has a molecular weight of 247.75 g/mol, XLogP of 0.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromocyclohexa-3,5-diene-1,3-diamine;nickel is sourced from PubChem (CID 87399379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).