About bromonickel;cyclohexa-3,5-diene-1,3-diamine
bromonickel;cyclohexa-3,5-diene-1,3-diamine (PubChem CID 87399380) has the molecular formula C6H9BrN2Ni-
and a molecular weight of 247.75 g/mol. Its IUPAC name is bromonickel;cyclohexa-3,5-diene-1,3-diamine.
Molecular Properties
| Compound Name | bromonickel;cyclohexa-3,5-diene-1,3-diamine |
| PubChem CID | 87399380 |
| Molecular Formula | C6H9BrN2Ni- |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 245.93 |
| IUPAC Name | bromonickel;cyclohexa-3,5-diene-1,3-diamine |
| SMILES | NC1=CC=C[C-](N)C1.[Ni]Br |
| InChI | InChI=1S/C6H9N2.BrH.Ni/c7-5-2-1-3-6(8)4-5;;/h1-3H,4,7-8H2;1H;/q-1;;+1/p-1 |
| InChIKey | RULYUDJULLQEKO-UHFFFAOYSA-M |
| XLogP | 1.12 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bromonickel;cyclohexa-3,5-diene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromonickel;cyclohexa-3,5-diene-1,3-diamine?
The IUPAC name of bromonickel;cyclohexa-3,5-diene-1,3-diamine (CID 87399380) is bromonickel;cyclohexa-3,5-diene-1,3-diamine.
What is the SMILES notation for bromonickel;cyclohexa-3,5-diene-1,3-diamine?
The canonical SMILES for bromonickel;cyclohexa-3,5-diene-1,3-diamine is NC1=CC=C[C-](N)C1.[Ni]Br.
What is the InChIKey of bromonickel;cyclohexa-3,5-diene-1,3-diamine?
The InChIKey is RULYUDJULLQEKO-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H9N2.BrH.Ni/c7-5-2-1-3-6(8)4-5;;/h1-3H,4,7-8H2;1H;/q-1;;+1/p-1.
What are the key properties of bromonickel;cyclohexa-3,5-diene-1,3-diamine?
bromonickel;cyclohexa-3,5-diene-1,3-diamine has a molecular weight of 247.75 g/mol, XLogP of 1.12, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromonickel;cyclohexa-3,5-diene-1,3-diamine is sourced from PubChem (CID 87399380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).