C21H28F3N3O5S — CID 87399571
[(2S)-5-[[(3aS,4S,6aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-1-oxopentan-2-yl]-methylcarbamic acid (PubChem CID 87399571) has the molecular formula C21H28F3N3O5S and a molecular weight of 491.53 g/mol. Its IUPAC name is [(2S)-5-[[(3aS,4S,6aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-1-oxopentan-2-yl]-methylcarbamic acid.
| Compound Name | [(2S)-5-[[(3aS,4S,6aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-1-oxopentan-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 87399571 |
| Molecular Formula | C21H28F3N3O5S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | [(2S)-5-[[(3aS,4S,6aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-1-oxopentan-2-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)[C@H](C=O)CCCN[C@H]1CC[C@H]2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)C[C@H]21 |
| InChI | InChI=1S/C21H28F3N3O5S/c1-26(20(29)30)16(13-28)3-2-10-25-19-9-4-14-11-27(12-18(14)19)33(31,32)17-7-5-15(6-8-17)21(22,23)24/h5-8,13-14,16,18-19,25H,2-4,9-12H2,1H3,(H,29,30)/t14-,16-,18+,19-/m0/s1 |
| InChIKey | DOYXPKHQJMNRDM-WQCNXYOZSA-N |
| XLogP | 2.65 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|