C18H11F4N7O3 — CID 87399742
[[N-(3-cyano-4-fluorophenyl)-C-[4-(pyridin-4-ylmethylamino)-1,2,5-oxadiazol-3-yl]carbonimidoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 87399742) has the molecular formula C18H11F4N7O3 and a molecular weight of 449.32 g/mol. Its IUPAC name is [[N-(3-cyano-4-fluorophenyl)-C-[4-(pyridin-4-ylmethylamino)-1,2,5-oxadiazol-3-yl]carbonimidoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[N-(3-cyano-4-fluorophenyl)-C-[4-(pyridin-4-ylmethylamino)-1,2,5-oxadiazol-3-yl]carbonimidoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87399742 |
| Molecular Formula | C18H11F4N7O3 |
| Molecular Weight | 449.32 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | [[N-(3-cyano-4-fluorophenyl)-C-[4-(pyridin-4-ylmethylamino)-1,2,5-oxadiazol-3-yl]carbonimidoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | N#Cc1cc(/N=C(\NOC(=O)C(F)(F)F)c2nonc2NCc2ccncc2)ccc1F |
| InChI | InChI=1S/C18H11F4N7O3/c19-13-2-1-12(7-11(13)8-23)26-16(28-31-17(30)18(20,21)22)14-15(29-32-27-14)25-9-10-3-5-24-6-4-10/h1-7H,9H2,(H,25,29)(H,26,28) |
| InChIKey | JDIWRLFSYXBNBJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|