C27H29N2O2P — CID 87399789
4,5-dihydro-1,3-oxazole;diphenyl-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane (PubChem CID 87399789) has the molecular formula C27H29N2O2P and a molecular weight of 444.52 g/mol. Its IUPAC name is 4,5-dihydro-1,3-oxazole;diphenyl-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane.
| Compound Name | 4,5-dihydro-1,3-oxazole;diphenyl-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 87399789 |
| Molecular Formula | C27H29N2O2P |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 4,5-dihydro-1,3-oxazole;diphenyl-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane |
| SMILES | C1=NCCO1.CC(C)[C@H]1COC(c2ccccc2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C24H24NOP.C3H5NO/c1-18(2)22-17-26-24(25-22)21-15-9-10-16-23(21)27(19-11-5-3-6-12-19)20-13-7-4-8-14-20;1-2-5-3-4-1/h3-16,18,22H,17H2,1-2H3;3H,1-2H2/t22-;/m1./s1 |
| InChIKey | AMHXVRNCYZHQDS-VZYDHVRKSA-N |
| XLogP | 4.29 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|