About 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione
1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione (PubChem CID 87400020) has the molecular formula C10H18N2S
and a molecular weight of 198.33 g/mol. Its IUPAC name is 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione.
Molecular Properties
| Compound Name | 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione |
| PubChem CID | 87400020 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione |
| SMILES | CCN1C(=S)N(CC)C(C)C=C1C |
| InChI | InChI=1S/C10H18N2S/c1-5-11-8(3)7-9(4)12(6-2)10(11)13/h7-8H,5-6H2,1-4H3 |
| InChIKey | ZYLYZMIUIYTOSH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione?
The IUPAC name of 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione (CID 87400020) is 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione.
What is the SMILES notation for 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione?
The canonical SMILES for 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione is CCN1C(=S)N(CC)C(C)C=C1C.
What is the InChIKey of 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione?
The InChIKey is ZYLYZMIUIYTOSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S/c1-5-11-8(3)7-9(4)12(6-2)10(11)13/h7-8H,5-6H2,1-4H3.
What are the key properties of 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione?
1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione has a molecular weight of 198.33 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-4,6-dimethyl-4H-pyrimidine-2-thione is sourced from PubChem (CID 87400020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).