C28H30F4O5S2 — CID 87400716
1,1,2,2-tetrafluoro-4-[1-(2-methylprop-2-enoxy)ethoxy]butane-1-sulfonate;triphenylsulfanium (PubChem CID 87400716) has the molecular formula C28H30F4O5S2 and a molecular weight of 586.67 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[1-(2-methylprop-2-enoxy)ethoxy]butane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,2,2-tetrafluoro-4-[1-(2-methylprop-2-enoxy)ethoxy]butane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 87400716 |
| Molecular Formula | C28H30F4O5S2 |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[1-(2-methylprop-2-enoxy)ethoxy]butane-1-sulfonate;triphenylsulfanium |
| SMILES | C=C(C)COC(C)OCCC(F)(F)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C10H16F4O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2)6-19-8(3)18-5-4-9(11,12)10(13,14)20(15,16)17/h1-15H;8H,1,4-6H2,2-3H3,(H,15,16,17)/q+1;/p-1 |
| InChIKey | GODXEETYIWXSRG-UHFFFAOYSA-M |
| XLogP | 6.89 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|