About (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene
(2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene (PubChem CID 87400955) has the molecular formula C12H26O4
and a molecular weight of 234.34 g/mol. Its IUPAC name is (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene.
Molecular Properties
| Compound Name | (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene |
| PubChem CID | 87400955 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene |
| SMILES | C=CC.COCCOC[C@H](C)OCCOC |
| InChI | InChI=1S/C9H20O4.C3H6/c1-9(13-7-5-11-3)8-12-6-4-10-2;1-3-2/h9H,4-8H2,1-3H3;3H,1H2,2H3/t9-;/m0./s1 |
| InChIKey | UMZRPAMOUXJYID-FVGYRXGTSA-N |
| XLogP | 1.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene?
The IUPAC name of (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene (CID 87400955) is (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene.
What is the SMILES notation for (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene?
The canonical SMILES for (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene is C=CC.COCCOC[C@H](C)OCCOC.
What is the InChIKey of (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene?
The InChIKey is UMZRPAMOUXJYID-FVGYRXGTSA-N. The full InChI is InChI=1S/C9H20O4.C3H6/c1-9(13-7-5-11-3)8-12-6-4-10-2;1-3-2/h9H,4-8H2,1-3H3;3H,1H2,2H3/t9-;/m0./s1.
What are the key properties of (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene?
(2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene has a molecular weight of 234.34 g/mol, XLogP of 1.89, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2-bis(2-methoxyethoxy)propane;prop-1-ene is sourced from PubChem (CID 87400955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).