C6H11F3N2O2S — CID 87401213
1-[(1S,2S)-2-aminocyclopentyl]-N,1,1-trifluoromethanesulfonamide (PubChem CID 87401213) has the molecular formula C6H11F3N2O2S and a molecular weight of 232.23 g/mol. Its IUPAC name is 1-[(1S,2S)-2-aminocyclopentyl]-N,1,1-trifluoromethanesulfonamide.
| Compound Name | 1-[(1S,2S)-2-aminocyclopentyl]-N,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 87401213 |
| Molecular Formula | C6H11F3N2O2S |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1-[(1S,2S)-2-aminocyclopentyl]-N,1,1-trifluoromethanesulfonamide |
| SMILES | N[C@H]1CCC[C@@H]1C(F)(F)S(=O)(=O)NF |
| InChI | InChI=1S/C6H11F3N2O2S/c7-6(8,14(12,13)11-9)4-2-1-3-5(4)10/h4-5,11H,1-3,10H2/t4-,5-/m0/s1 |
| InChIKey | FJJSDSGEQJNQMC-WHFBIAKZSA-N |
| XLogP | 0.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|