C15H19NO5 — CID 87401432
[(2S)-2-[(1R,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-methoxy-3-phenylpropyl] carbamate (PubChem CID 87401432) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is [(2S)-2-[(1R,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-methoxy-3-phenylpropyl] carbamate.
| Compound Name | [(2S)-2-[(1R,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-methoxy-3-phenylpropyl] carbamate |
|---|---|
| PubChem CID | 87401432 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [(2S)-2-[(1R,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-methoxy-3-phenylpropyl] carbamate |
| SMILES | CO[C@](COC(N)=O)(Cc1ccccc1)[C@@H]1OC[C@@H]2O[C@H]21 |
| InChI | InChI=1S/C15H19NO5/c1-18-15(9-20-14(16)17,7-10-5-3-2-4-6-10)13-12-11(21-12)8-19-13/h2-6,11-13H,7-9H2,1H3,(H2,16,17)/t11-,12+,13+,15-/m0/s1 |
| InChIKey | ADTNMBUTSFWAEO-JLNYLFASSA-N |
| XLogP | 0.88 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|