C11HF23O — CID 87401623
1,1,1,2,2,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecan-3-ol (PubChem CID 87401623) has the molecular formula C11HF23O and a molecular weight of 586.08 g/mol. Its IUPAC name is 1,1,1,2,2,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecan-3-ol.
| Compound Name | 1,1,1,2,2,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecan-3-ol |
|---|---|
| PubChem CID | 87401623 |
| Molecular Formula | C11HF23O |
| Molecular Weight | 586.08 g/mol |
| Exact Mass | 585.97 |
| IUPAC Name | 1,1,1,2,2,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecan-3-ol |
| SMILES | OC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11HF23O/c12-1(13,3(16,17)5(20,21)7(24,25)10(29,30)31)2(14,15)4(18,19)6(22,23)9(28,35)8(26,27)11(32,33)34/h35H |
| InChIKey | UFFDSAFACGIVQZ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.08 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|