About ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid
ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid (PubChem CID 87401708) has the molecular formula C16H32O6
and a molecular weight of 320.43 g/mol. Its IUPAC name is ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid.
Molecular Properties
| Compound Name | ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid |
| PubChem CID | 87401708 |
| Molecular Formula | C16H32O6 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid |
| SMILES | CCC(CCCCO)C(=O)O.CCOC(=O)CCCCCO |
| InChI | InChI=1S/2C8H16O3/c1-2-11-8(10)6-4-3-5-7-9;1-2-7(8(10)11)5-3-4-6-9/h9H,2-7H2,1H3;7,9H,2-6H2,1H3,(H,10,11) |
| InChIKey | BOOQZXRSDOBKSV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid?
The IUPAC name of ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid (CID 87401708) is ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid.
What is the SMILES notation for ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid?
The canonical SMILES for ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid is CCC(CCCCO)C(=O)O.CCOC(=O)CCCCCO.
What is the InChIKey of ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid?
The InChIKey is BOOQZXRSDOBKSV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H16O3/c1-2-11-8(10)6-4-3-5-7-9;1-2-7(8(10)11)5-3-4-6-9/h9H,2-7H2,1H3;7,9H,2-6H2,1H3,(H,10,11).
What are the key properties of ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid?
ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid has a molecular weight of 320.43 g/mol, XLogP of 2.36, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-hydroxyhexanoate;2-ethyl-6-hydroxyhexanoic acid is sourced from PubChem (CID 87401708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).