About ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate
ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate (PubChem CID 87401783) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate |
| PubChem CID | 87401783 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate |
| SMILES | CCOC(=O)/C(O)=C\C(=O)CC(C)(C)C |
| InChI | InChI=1S/C11H18O4/c1-5-15-10(14)9(13)6-8(12)7-11(2,3)4/h6,13H,5,7H2,1-4H3/b9-6+ |
| InChIKey | PSKRCPXJFSMTCU-RMKNXTFCSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate?
The IUPAC name of ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate (CID 87401783) is ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate.
What is the SMILES notation for ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate?
The canonical SMILES for ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate is CCOC(=O)/C(O)=C\C(=O)CC(C)(C)C.
What is the InChIKey of ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate?
The InChIKey is PSKRCPXJFSMTCU-RMKNXTFCSA-N. The full InChI is InChI=1S/C11H18O4/c1-5-15-10(14)9(13)6-8(12)7-11(2,3)4/h6,13H,5,7H2,1-4H3/b9-6+.
What are the key properties of ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate?
ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate has a molecular weight of 214.26 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2-hydroxy-6,6-dimethyl-4-oxohept-2-enoate is sourced from PubChem (CID 87401783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).