About 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid
2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid (PubChem CID 87402079) has the molecular formula C16H22O5
and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid |
| PubChem CID | 87402079 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid |
| SMILES | C=CCCC(=C)C(=O)O.O=C(O)C1=CCCC1CC1CO1 |
| InChI | InChI=1S/C9H12O3.C7H10O2/c10-9(11)8-3-1-2-6(8)4-7-5-12-7;1-3-4-5-6(2)7(8)9/h3,6-7H,1-2,4-5H2,(H,10,11);3H,1-2,4-5H2,(H,8,9) |
| InChIKey | BWLJSQFKQOBDDO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid?
The IUPAC name of 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid (CID 87402079) is 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid.
What is the SMILES notation for 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid?
The canonical SMILES for 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid is C=CCCC(=C)C(=O)O.O=C(O)C1=CCCC1CC1CO1.
What is the InChIKey of 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid?
The InChIKey is BWLJSQFKQOBDDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3.C7H10O2/c10-9(11)8-3-1-2-6(8)4-7-5-12-7;1-3-4-5-6(2)7(8)9/h3,6-7H,1-2,4-5H2,(H,10,11);3H,1-2,4-5H2,(H,8,9).
What are the key properties of 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid?
2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid has a molecular weight of 294.35 g/mol, XLogP of 2.79, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenehex-5-enoic acid;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid is sourced from PubChem (CID 87402079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).