C32H34F4O5S2 — CID 87402490
2-[6-(2,2-dimethylpropanoyloxy)-2-bicyclo[2.2.1]heptanyl]-1,1,2,2-tetrafluoroethanesulfonate;triphenylsulfanium (PubChem CID 87402490) has the molecular formula C32H34F4O5S2 and a molecular weight of 638.75 g/mol. Its IUPAC name is 2-[6-(2,2-dimethylpropanoyloxy)-2-bicyclo[2.2.1]heptanyl]-1,1,2,2-tetrafluoroethanesulfonate;triphenylsulfanium.
| Compound Name | 2-[6-(2,2-dimethylpropanoyloxy)-2-bicyclo[2.2.1]heptanyl]-1,1,2,2-tetrafluoroethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 87402490 |
| Molecular Formula | C32H34F4O5S2 |
| Molecular Weight | 638.75 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | 2-[6-(2,2-dimethylpropanoyloxy)-2-bicyclo[2.2.1]heptanyl]-1,1,2,2-tetrafluoroethanesulfonate;triphenylsulfanium |
| SMILES | CC(C)(C)C(=O)OC1CC2CC1C(C(F)(F)C(F)(F)S(=O)(=O)[O-])C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C14H20F4O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-12(2,3)11(19)23-10-6-7-4-8(10)9(5-7)13(15,16)14(17,18)24(20,21)22/h1-15H;7-10H,4-6H2,1-3H3,(H,20,21,22)/q+1;/p-1 |
| InChIKey | YPPBQOYMMQUOTG-UHFFFAOYSA-M |
| XLogP | 7.55 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.75 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|