C27H24F4O4S2 — CID 87402729
1,1,2,2-tetrafluoro-2-(5-oxo-2-bicyclo[2.2.1]heptanyl)ethanesulfonate;triphenylsulfanium (PubChem CID 87402729) has the molecular formula C27H24F4O4S2 and a molecular weight of 552.61 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(5-oxo-2-bicyclo[2.2.1]heptanyl)ethanesulfonate;triphenylsulfanium.
| Compound Name | 1,1,2,2-tetrafluoro-2-(5-oxo-2-bicyclo[2.2.1]heptanyl)ethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 87402729 |
| Molecular Formula | C27H24F4O4S2 |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(5-oxo-2-bicyclo[2.2.1]heptanyl)ethanesulfonate;triphenylsulfanium |
| SMILES | O=C1CC2CC1CC2C(F)(F)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C9H10F4O4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;10-8(11,9(12,13)18(15,16)17)6-2-5-1-4(6)3-7(5)14/h1-15H;4-6H,1-3H2,(H,15,16,17)/q+1;/p-1 |
| InChIKey | XYLABXNOHWQFQR-UHFFFAOYSA-M |
| XLogP | 6.16 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|