C12H18F4O6S2 — CID 87402846
1,1,2,2-tetrafluoro-2-(6-propan-2-ylsulfonyloxy-2-bicyclo[2.2.1]heptanyl)ethanesulfonic acid (PubChem CID 87402846) has the molecular formula C12H18F4O6S2 and a molecular weight of 398.40 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(6-propan-2-ylsulfonyloxy-2-bicyclo[2.2.1]heptanyl)ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-(6-propan-2-ylsulfonyloxy-2-bicyclo[2.2.1]heptanyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 87402846 |
| Molecular Formula | C12H18F4O6S2 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(6-propan-2-ylsulfonyloxy-2-bicyclo[2.2.1]heptanyl)ethanesulfonic acid |
| SMILES | CC(C)S(=O)(=O)OC1CC2CC1C(C(F)(F)C(F)(F)S(=O)(=O)O)C2 |
| InChI | InChI=1S/C12H18F4O6S2/c1-6(2)23(17,18)22-10-5-7-3-8(10)9(4-7)11(13,14)12(15,16)24(19,20)21/h6-10H,3-5H2,1-2H3,(H,19,20,21) |
| InChIKey | ORCVHAQSZWOTDV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|