About lithium prop-2-enyl sulfate
lithium prop-2-enyl sulfate (PubChem CID 87403119) has the molecular formula C3H5LiO4S
and a molecular weight of 144.08 g/mol. Its IUPAC name is lithium prop-2-enyl sulfate.
Molecular Properties
| Compound Name | lithium prop-2-enyl sulfate |
| PubChem CID | 87403119 |
| Molecular Formula | C3H5LiO4S |
| Molecular Weight | 144.08 g/mol |
| Exact Mass | 144.01 |
| IUPAC Name | lithium prop-2-enyl sulfate |
| SMILES | C=CCOS(=O)(=O)[O-].[Li+] |
| InChI | InChI=1S/C3H6O4S.Li/c1-2-3-7-8(4,5)6;/h2H,1,3H2,(H,4,5,6);/q;+1/p-1 |
| InChIKey | KRPLLEPNPFBBFT-UHFFFAOYSA-M |
| XLogP | -3.35 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.08 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze lithium prop-2-enyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium prop-2-enyl sulfate?
The IUPAC name of lithium prop-2-enyl sulfate (CID 87403119) is lithium prop-2-enyl sulfate.
What is the SMILES notation for lithium prop-2-enyl sulfate?
The canonical SMILES for lithium prop-2-enyl sulfate is C=CCOS(=O)(=O)[O-].[Li+].
What is the InChIKey of lithium prop-2-enyl sulfate?
The InChIKey is KRPLLEPNPFBBFT-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O4S.Li/c1-2-3-7-8(4,5)6;/h2H,1,3H2,(H,4,5,6);/q;+1/p-1.
What are the key properties of lithium prop-2-enyl sulfate?
lithium prop-2-enyl sulfate has a molecular weight of 144.08 g/mol, XLogP of -3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium prop-2-enyl sulfate is sourced from PubChem (CID 87403119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).