About zinc;6-ethyl-2H-pyridin-2-ide;chloride
zinc;6-ethyl-2H-pyridin-2-ide;chloride (PubChem CID 87403247) has the molecular formula C7H8ClNZn
and a molecular weight of 206.99 g/mol. Its IUPAC name is zinc;6-ethyl-2H-pyridin-2-ide;chloride.
Molecular Properties
| Compound Name | zinc;6-ethyl-2H-pyridin-2-ide;chloride |
| PubChem CID | 87403247 |
| Molecular Formula | C7H8ClNZn |
| Molecular Weight | 206.99 g/mol |
| Exact Mass | 204.96 |
| IUPAC Name | zinc;6-ethyl-2H-pyridin-2-ide;chloride |
| SMILES | CCc1ccc[c-]n1.[Cl-].[Zn+2] |
| InChI | InChI=1S/C7H8N.ClH.Zn/c1-2-7-5-3-4-6-8-7;;/h3-5H,2H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | NMDQUXYNHQQIAL-UHFFFAOYSA-M |
| XLogP | -1.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.99 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;6-ethyl-2H-pyridin-2-ide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;6-ethyl-2H-pyridin-2-ide;chloride?
The IUPAC name of zinc;6-ethyl-2H-pyridin-2-ide;chloride (CID 87403247) is zinc;6-ethyl-2H-pyridin-2-ide;chloride.
What is the SMILES notation for zinc;6-ethyl-2H-pyridin-2-ide;chloride?
The canonical SMILES for zinc;6-ethyl-2H-pyridin-2-ide;chloride is CCc1ccc[c-]n1.[Cl-].[Zn+2].
What is the InChIKey of zinc;6-ethyl-2H-pyridin-2-ide;chloride?
The InChIKey is NMDQUXYNHQQIAL-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8N.ClH.Zn/c1-2-7-5-3-4-6-8-7;;/h3-5H,2H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of zinc;6-ethyl-2H-pyridin-2-ide;chloride?
zinc;6-ethyl-2H-pyridin-2-ide;chloride has a molecular weight of 206.99 g/mol, XLogP of -1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;6-ethyl-2H-pyridin-2-ide;chloride is sourced from PubChem (CID 87403247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).