C23H21F3N4S — CID 87403424
(2R)-3-[4-(1,1-difluoroethyl)phenyl]-1-N-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]propane-1,2-diamine (PubChem CID 87403424) has the molecular formula C23H21F3N4S and a molecular weight of 442.51 g/mol. Its IUPAC name is (2R)-3-[4-(1,1-difluoroethyl)phenyl]-1-N-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]propane-1,2-diamine.
| Compound Name | (2R)-3-[4-(1,1-difluoroethyl)phenyl]-1-N-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]propane-1,2-diamine |
|---|---|
| PubChem CID | 87403424 |
| Molecular Formula | C23H21F3N4S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | (2R)-3-[4-(1,1-difluoroethyl)phenyl]-1-N-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]propane-1,2-diamine |
| SMILES | CC(F)(F)c1ccc(C[C@@H](N)CNc2ncc(-c3ccc4cnc(F)cc4c3)s2)cc1 |
| InChI | InChI=1S/C23H21F3N4S/c1-23(25,26)18-6-2-14(3-7-18)8-19(27)12-29-22-30-13-20(31-22)15-4-5-16-11-28-21(24)10-17(16)9-15/h2-7,9-11,13,19H,8,12,27H2,1H3,(H,29,30)/t19-/m1/s1 |
| InChIKey | JYYHEWWFBMIXPW-LJQANCHMSA-N |
| XLogP | 5.59 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|