About N'-ethenylprop-2-enimidamide;hydrochloride
N'-ethenylprop-2-enimidamide;hydrochloride (PubChem CID 87403639) has the molecular formula C5H9ClN2
and a molecular weight of 132.59 g/mol. Its IUPAC name is N'-ethenylprop-2-enimidamide;hydrochloride.
Molecular Properties
| Compound Name | N'-ethenylprop-2-enimidamide;hydrochloride |
| PubChem CID | 87403639 |
| Molecular Formula | C5H9ClN2 |
| Molecular Weight | 132.59 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | N'-ethenylprop-2-enimidamide;hydrochloride |
| SMILES | C=C/N=C(/N)C=C.Cl |
| InChI | InChI=1S/C5H8N2.ClH/c1-3-5(6)7-4-2;/h3-4H,1-2H2,(H2,6,7);1H |
| InChIKey | KWQCSIPJQQXVEQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.59 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-ethenylprop-2-enimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethenylprop-2-enimidamide;hydrochloride?
The IUPAC name of N'-ethenylprop-2-enimidamide;hydrochloride (CID 87403639) is N'-ethenylprop-2-enimidamide;hydrochloride.
What is the SMILES notation for N'-ethenylprop-2-enimidamide;hydrochloride?
The canonical SMILES for N'-ethenylprop-2-enimidamide;hydrochloride is C=C/N=C(/N)C=C.Cl.
What is the InChIKey of N'-ethenylprop-2-enimidamide;hydrochloride?
The InChIKey is KWQCSIPJQQXVEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.ClH/c1-3-5(6)7-4-2;/h3-4H,1-2H2,(H2,6,7);1H.
What are the key properties of N'-ethenylprop-2-enimidamide;hydrochloride?
N'-ethenylprop-2-enimidamide;hydrochloride has a molecular weight of 132.59 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethenylprop-2-enimidamide;hydrochloride is sourced from PubChem (CID 87403639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).