C20H16Cl2F3N3O3 — CID 87403656
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-3-[(E)-methoxyiminomethyl]-2-methylbenzamide (PubChem CID 87403656) has the molecular formula C20H16Cl2F3N3O3 and a molecular weight of 474.27 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-3-[(E)-methoxyiminomethyl]-2-methylbenzamide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-3-[(E)-methoxyiminomethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 87403656 |
| Molecular Formula | C20H16Cl2F3N3O3 |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-3-[(E)-methoxyiminomethyl]-2-methylbenzamide |
| SMILES | CO/N=C/c1c(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc(C(N)=O)c1C |
| InChI | InChI=1S/C20H16Cl2F3N3O3/c1-10-14(18(26)29)3-4-15(16(10)9-27-30-2)17-8-19(31-28-17,20(23,24)25)11-5-12(21)7-13(22)6-11/h3-7,9H,8H2,1-2H3,(H2,26,29)/b27-9+ |
| InChIKey | ICFFTXKJVNWQHV-OXUBWTJQSA-N |
| XLogP | 4.96 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|