C16H33Cl5N4O4P2 — CID 87403810
N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;N,N,3-tris(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine (PubChem CID 87403810) has the molecular formula C16H33Cl5N4O4P2 and a molecular weight of 584.68 g/mol. Its IUPAC name is N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;N,N,3-tris(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
| Compound Name | N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;N,N,3-tris(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
|---|---|
| PubChem CID | 87403810 |
| Molecular Formula | C16H33Cl5N4O4P2 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 582.04 |
| IUPAC Name | N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;N,N,3-tris(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
| SMILES | O=P1(N(CCCl)CCCl)OCCCN1CCCl.O=P1(NCCCl)OCCCN1CCCl |
| InChI | InChI=1S/C9H18Cl3N2O2P.C7H15Cl2N2O2P/c10-2-6-13-5-1-9-16-17(13,15)14(7-3-11)8-4-12;8-2-4-10-14(12)11(6-3-9)5-1-7-13-14/h1-9H2;1-7H2,(H,10,12) |
| InChIKey | CICYFGGWYVMYQF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|