About 2-chloro-1,1,4,4-tetrafluorobut-1-ene
2-chloro-1,1,4,4-tetrafluorobut-1-ene (PubChem CID 87404344) has the molecular formula C4H3ClF4
and a molecular weight of 162.51 g/mol. Its IUPAC name is 2-chloro-1,1,4,4-tetrafluorobut-1-ene.
Molecular Properties
| Compound Name | 2-chloro-1,1,4,4-tetrafluorobut-1-ene |
| PubChem CID | 87404344 |
| Molecular Formula | C4H3ClF4 |
| Molecular Weight | 162.51 g/mol |
| Exact Mass | 161.99 |
| IUPAC Name | 2-chloro-1,1,4,4-tetrafluorobut-1-ene |
| SMILES | FC(F)=C(Cl)CC(F)F |
| InChI | InChI=1S/C4H3ClF4/c5-2(4(8)9)1-3(6)7/h3H,1H2 |
| InChIKey | SBGXJDCLUGWVBC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-chloro-1,1,4,4-tetrafluorobut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,1,4,4-tetrafluorobut-1-ene?
The IUPAC name of 2-chloro-1,1,4,4-tetrafluorobut-1-ene (CID 87404344) is 2-chloro-1,1,4,4-tetrafluorobut-1-ene.
What is the SMILES notation for 2-chloro-1,1,4,4-tetrafluorobut-1-ene?
The canonical SMILES for 2-chloro-1,1,4,4-tetrafluorobut-1-ene is FC(F)=C(Cl)CC(F)F.
What is the InChIKey of 2-chloro-1,1,4,4-tetrafluorobut-1-ene?
The InChIKey is SBGXJDCLUGWVBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3ClF4/c5-2(4(8)9)1-3(6)7/h3H,1H2.
What are the key properties of 2-chloro-1,1,4,4-tetrafluorobut-1-ene?
2-chloro-1,1,4,4-tetrafluorobut-1-ene has a molecular weight of 162.51 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,1,4,4-tetrafluorobut-1-ene is sourced from PubChem (CID 87404344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).