C26H27FN2O4S — CID 87404568
tert-butyl N-fluoro-N-[2-[4-(8-methoxy-6-methyl-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]ethyl]carbamate (PubChem CID 87404568) has the molecular formula C26H27FN2O4S and a molecular weight of 482.58 g/mol. Its IUPAC name is tert-butyl N-fluoro-N-[2-[4-(8-methoxy-6-methyl-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-fluoro-N-[2-[4-(8-methoxy-6-methyl-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 87404568 |
| Molecular Formula | C26H27FN2O4S |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | tert-butyl N-fluoro-N-[2-[4-(8-methoxy-6-methyl-4-oxo-5H-thieno[2,3-c]quinolin-9-yl)phenyl]ethyl]carbamate |
| SMILES | COc1cc(C)c2[nH]c(=O)c3sccc3c2c1-c1ccc(CCN(F)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H27FN2O4S/c1-15-14-19(32-5)20(21-18-11-13-34-23(18)24(30)28-22(15)21)17-8-6-16(7-9-17)10-12-29(27)25(31)33-26(2,3)4/h6-9,11,13-14H,10,12H2,1-5H3,(H,28,30) |
| InChIKey | RRQPYLGVJCXXGJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|