About 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+)
2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+) (PubChem CID 87404819) has the molecular formula C18H14N3O6Ru
and a molecular weight of 469.40 g/mol. Its IUPAC name is 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+).
Molecular Properties
| Compound Name | 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+) |
| PubChem CID | 87404819 |
| Molecular Formula | C18H14N3O6Ru |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+) |
| SMILES | O=[C-]O.O=[C-]O.O=[C-]O.[Ru+3].c1ccc(-c2cccnc2-c2ccccn2)nc1 |
| InChI | InChI=1S/C15H11N3.3CHO2.Ru/c1-3-9-16-13(7-1)12-6-5-11-18-15(12)14-8-2-4-10-17-14;3*2-1-3;/h1-11H;3*(H,2,3);/q;3*-1;+3 |
| InChIKey | HLLNRQFYIRGGBA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 150.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+)?
The IUPAC name of 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+) (CID 87404819) is 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+).
What is the SMILES notation for 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+)?
The canonical SMILES for 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+) is O=[C-]O.O=[C-]O.O=[C-]O.[Ru+3].c1ccc(-c2cccnc2-c2ccccn2)nc1.
What is the InChIKey of 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+)?
The InChIKey is HLLNRQFYIRGGBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3.3CHO2.Ru/c1-3-9-16-13(7-1)12-6-5-11-18-15(12)14-8-2-4-10-17-14;3*2-1-3;/h1-11H;3*(H,2,3);/q;3*-1;+3.
What are the key properties of 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+)?
2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+) has a molecular weight of 469.40 g/mol, XLogP of 2.04, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dipyridin-2-ylpyridine;hydroxymethanone;ruthenium(3+) is sourced from PubChem (CID 87404819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).