C11H6BrF3N2O — CID 87405001
5-bromo-1-methyl-3-(2,3,4-trifluorophenyl)pyrazole-4-carbaldehyde (PubChem CID 87405001) has the molecular formula C11H6BrF3N2O and a molecular weight of 319.08 g/mol. Its IUPAC name is 5-bromo-1-methyl-3-(2,3,4-trifluorophenyl)pyrazole-4-carbaldehyde.
| Compound Name | 5-bromo-1-methyl-3-(2,3,4-trifluorophenyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 87405001 |
| Molecular Formula | C11H6BrF3N2O |
| Molecular Weight | 319.08 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 5-bromo-1-methyl-3-(2,3,4-trifluorophenyl)pyrazole-4-carbaldehyde |
| SMILES | Cn1nc(-c2ccc(F)c(F)c2F)c(C=O)c1Br |
| InChI | InChI=1S/C11H6BrF3N2O/c1-17-11(12)6(4-18)10(16-17)5-2-3-7(13)9(15)8(5)14/h2-4H,1H3 |
| InChIKey | BVOWRKCAYWBZDF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.08 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|