C17H16N4OS — CID 87405083
1-[(4-methylphenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea (PubChem CID 87405083) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(4-methylphenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 87405083 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1ccc(CNC(=O)Nc2nc(-c3ccncc3)cs2)cc1 |
| InChI | InChI=1S/C17H16N4OS/c1-12-2-4-13(5-3-12)10-19-16(22)21-17-20-15(11-23-17)14-6-8-18-9-7-14/h2-9,11H,10H2,1H3,(H2,19,20,21,22) |
| InChIKey | WBRWCBQGSFXWIW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |