About 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde
5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde (PubChem CID 87405510) has the molecular formula C16H8BrF3N2O
and a molecular weight of 381.15 g/mol. Its IUPAC name is 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde |
| PubChem CID | 87405510 |
| Molecular Formula | C16H8BrF3N2O |
| Molecular Weight | 381.15 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde |
| SMILES | O=Cc1c(-c2cccc(F)c2F)nn(-c2ccc(F)cc2)c1Br |
| InChI | InChI=1S/C16H8BrF3N2O/c17-16-12(8-23)15(11-2-1-3-13(19)14(11)20)21-22(16)10-6-4-9(18)5-7-10/h1-8H |
| InChIKey | XURBXXPJMZOSRD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.15 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde?
The IUPAC name of 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde (CID 87405510) is 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde.
What is the SMILES notation for 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde?
The canonical SMILES for 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde is O=Cc1c(-c2cccc(F)c2F)nn(-c2ccc(F)cc2)c1Br.
What is the InChIKey of 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde?
The InChIKey is XURBXXPJMZOSRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8BrF3N2O/c17-16-12(8-23)15(11-2-1-3-13(19)14(11)20)21-22(16)10-6-4-9(18)5-7-10/h1-8H.
What are the key properties of 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde?
5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde has a molecular weight of 381.15 g/mol, XLogP of 4.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(2,3-difluorophenyl)-1-(4-fluorophenyl)pyrazole-4-carbaldehyde is sourced from PubChem (CID 87405510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).