About 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine
4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine (PubChem CID 87405810) has the molecular formula C17H29N
and a molecular weight of 247.43 g/mol. Its IUPAC name is 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine.
Molecular Properties
| Compound Name | 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine |
| PubChem CID | 87405810 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine |
| SMILES | C=CCC(N)(CC=C)C(CC=C)(CC=C)CCC |
| InChI | InChI=1S/C17H29N/c1-6-11-16(12-7-2,13-8-3)17(18,14-9-4)15-10-5/h6-7,9-10H,1-2,4-5,8,11-15,18H2,3H3 |
| InChIKey | UTWNMLOFXSVHEU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine?
The IUPAC name of 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine (CID 87405810) is 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine.
What is the SMILES notation for 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine?
The canonical SMILES for 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine is C=CCC(N)(CC=C)C(CC=C)(CC=C)CCC.
What is the InChIKey of 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine?
The InChIKey is UTWNMLOFXSVHEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N/c1-6-11-16(12-7-2,13-8-3)17(18,14-9-4)15-10-5/h6-7,9-10H,1-2,4-5,8,11-15,18H2,3H3.
What are the key properties of 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine?
4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine has a molecular weight of 247.43 g/mol, XLogP of 4.77, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(prop-2-enyl)-5-propylocta-1,7-dien-4-amine is sourced from PubChem (CID 87405810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).