About 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea
1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea (PubChem CID 87405826) has the molecular formula C19H20N4O3S
and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea |
| PubChem CID | 87405826 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea |
| SMILES | COCCOc1cccc(CNC(=O)Nc2nc(-c3ccncc3)cs2)c1 |
| InChI | InChI=1S/C19H20N4O3S/c1-25-9-10-26-16-4-2-3-14(11-16)12-21-18(24)23-19-22-17(13-27-19)15-5-7-20-8-6-15/h2-8,11,13H,9-10,12H2,1H3,(H2,21,22,23,24) |
| InChIKey | WWZHQXSBWHHZMU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea (CID 87405826) is 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea is COCCOc1cccc(CNC(=O)Nc2nc(-c3ccncc3)cs2)c1.
What is the InChIKey of 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea?
The InChIKey is WWZHQXSBWHHZMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O3S/c1-25-9-10-26-16-4-2-3-14(11-16)12-21-18(24)23-19-22-17(13-27-19)15-5-7-20-8-6-15/h2-8,11,13H,9-10,12H2,1H3,(H2,21,22,23,24).
What are the key properties of 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea?
1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea has a molecular weight of 384.46 g/mol, XLogP of 3.55, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-(2-methoxyethoxy)phenyl]methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 87405826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).