About 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea
1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea (PubChem CID 87405986) has the molecular formula C16H12Cl2N4OS
and a molecular weight of 379.27 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea |
| PubChem CID | 87405986 |
| Molecular Formula | C16H12Cl2N4OS |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)Nc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C16H12Cl2N4OS/c17-12-2-1-11(13(18)7-12)8-20-15(23)22-16-21-14(9-24-16)10-3-5-19-6-4-10/h1-7,9H,8H2,(H2,20,21,22,23) |
| InChIKey | LEPALJQDUNFIBP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea (CID 87405986) is 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea is O=C(NCc1ccc(Cl)cc1Cl)Nc1nc(-c2ccncc2)cs1.
What is the InChIKey of 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea?
The InChIKey is LEPALJQDUNFIBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2N4OS/c17-12-2-1-11(13(18)7-12)8-20-15(23)22-16-21-14(9-24-16)10-3-5-19-6-4-10/h1-7,9H,8H2,(H2,20,21,22,23).
What are the key properties of 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea?
1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea has a molecular weight of 379.27 g/mol, XLogP of 4.83, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dichlorophenyl)methyl]-3-(4-pyridin-4-yl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 87405986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).