C14H17ClO4 — CID 87406273
2-(2-chloro-4-formylphenoxy)-2,4-dimethylpentanoic acid (PubChem CID 87406273) has the molecular formula C14H17ClO4 and a molecular weight of 284.74 g/mol. Its IUPAC name is 2-(2-chloro-4-formylphenoxy)-2,4-dimethylpentanoic acid.
| Compound Name | 2-(2-chloro-4-formylphenoxy)-2,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 87406273 |
| Molecular Formula | C14H17ClO4 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-(2-chloro-4-formylphenoxy)-2,4-dimethylpentanoic acid |
| SMILES | CC(C)CC(C)(Oc1ccc(C=O)cc1Cl)C(=O)O |
| InChI | InChI=1S/C14H17ClO4/c1-9(2)7-14(3,13(17)18)19-12-5-4-10(8-16)6-11(12)15/h4-6,8-9H,7H2,1-3H3,(H,17,18) |
| InChIKey | DKILTFWRYGAQTK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|