C17H19FN2O3S2 — CID 8740673
(2R)-2-(4-fluorophenyl)sulfanyl-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 8740673) has the molecular formula C17H19FN2O3S2 and a molecular weight of 382.48 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)sulfanyl-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | (2R)-2-(4-fluorophenyl)sulfanyl-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 8740673 |
| Molecular Formula | C17H19FN2O3S2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)sulfanyl-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | C[C@@H](Sc1ccc(F)cc1)C(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H19FN2O3S2/c1-12(24-15-6-4-14(18)5-7-15)17(21)20-11-10-13-2-8-16(9-3-13)25(19,22)23/h2-9,12H,10-11H2,1H3,(H,20,21)(H2,19,22,23)/t12-/m1/s1 |
| InChIKey | UDEUSEZPXCVKRX-GFCCVEGCSA-N |
| XLogP | 2.31 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |