About 2,3,5-trimethylbenzene-1,4-diol
2,3,5-trimethylbenzene-1,4-diol (PubChem CID 87406815) has the molecular formula C18H24O4
and a molecular weight of 304.39 g/mol. Its IUPAC name is 2,3,5-trimethylbenzene-1,4-diol.
Molecular Properties
| Compound Name | 2,3,5-trimethylbenzene-1,4-diol |
| PubChem CID | 87406815 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2,3,5-trimethylbenzene-1,4-diol |
| SMILES | Cc1cc(O)c(C)c(C)c1O.Cc1cc(O)c(C)c(C)c1O |
| InChI | InChI=1S/2C9H12O2/c2*1-5-4-8(10)6(2)7(3)9(5)11/h2*4,10-11H,1-3H3 |
| InChIKey | AFPHZHOLGGVOFO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,3,5-trimethylbenzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-trimethylbenzene-1,4-diol?
The IUPAC name of 2,3,5-trimethylbenzene-1,4-diol (CID 87406815) is 2,3,5-trimethylbenzene-1,4-diol.
What is the SMILES notation for 2,3,5-trimethylbenzene-1,4-diol?
The canonical SMILES for 2,3,5-trimethylbenzene-1,4-diol is Cc1cc(O)c(C)c(C)c1O.Cc1cc(O)c(C)c(C)c1O.
What is the InChIKey of 2,3,5-trimethylbenzene-1,4-diol?
The InChIKey is AFPHZHOLGGVOFO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H12O2/c2*1-5-4-8(10)6(2)7(3)9(5)11/h2*4,10-11H,1-3H3.
What are the key properties of 2,3,5-trimethylbenzene-1,4-diol?
2,3,5-trimethylbenzene-1,4-diol has a molecular weight of 304.39 g/mol, XLogP of 4.05, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-trimethylbenzene-1,4-diol is sourced from PubChem (CID 87406815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).