C9H23N3 — CID 87406982
1-N,1-N,1-N',1-N',3-N,3-N-hexamethylpropane-1,1,3-triamine (PubChem CID 87406982) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',3-N,3-N-hexamethylpropane-1,1,3-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',3-N,3-N-hexamethylpropane-1,1,3-triamine |
|---|---|
| PubChem CID | 87406982 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | 1-N,1-N,1-N',1-N',3-N,3-N-hexamethylpropane-1,1,3-triamine |
| SMILES | CN(C)CCC(N(C)C)N(C)C |
| InChI | InChI=1S/C9H23N3/c1-10(2)8-7-9(11(3)4)12(5)6/h9H,7-8H2,1-6H3 |
| InChIKey | KLHDSUSQPANGCS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|