About [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate
[3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate (PubChem CID 87407136) has the molecular formula C21H22FIN4O4
and a molecular weight of 540.33 g/mol. Its IUPAC name is [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate.
Molecular Properties
| Compound Name | [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate |
| PubChem CID | 87407136 |
| Molecular Formula | C21H22FIN4O4 |
| Molecular Weight | 540.33 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate |
| SMILES | O=C(NOCCN1CCCCC1)Oc1oc2ccncc2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C21H22FIN4O4/c22-16-12-14(23)4-5-17(16)25-19-15-13-24-7-6-18(15)30-20(19)31-21(28)26-29-11-10-27-8-2-1-3-9-27/h4-7,12-13,25H,1-3,8-11H2,(H,26,28) |
| InChIKey | XQRLXLVWATWIJM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 540.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate?
The IUPAC name of [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate (CID 87407136) is [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate.
What is the SMILES notation for [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate?
The canonical SMILES for [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate is O=C(NOCCN1CCCCC1)Oc1oc2ccncc2c1Nc1ccc(I)cc1F.
What is the InChIKey of [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate?
The InChIKey is XQRLXLVWATWIJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FIN4O4/c22-16-12-14(23)4-5-17(16)25-19-15-13-24-7-6-18(15)30-20(19)31-21(28)26-29-11-10-27-8-2-1-3-9-27/h4-7,12-13,25H,1-3,8-11H2,(H,26,28).
What are the key properties of [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate?
[3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate has a molecular weight of 540.33 g/mol, XLogP of 4.82, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-piperidin-1-ylethoxy)carbamate is sourced from PubChem (CID 87407136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).