About 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide
3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide (PubChem CID 87407288) has the molecular formula C17H21N3O5
and a molecular weight of 347.37 g/mol. Its IUPAC name is 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide.
Molecular Properties
| Compound Name | 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide |
| PubChem CID | 87407288 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide |
| SMILES | O=Cc1c(O)ccc2oc(CCC(=O)NCCN3CCOCC3)nc12 |
| InChI | InChI=1S/C17H21N3O5/c21-11-12-13(22)1-2-14-17(12)19-16(25-14)4-3-15(23)18-5-6-20-7-9-24-10-8-20/h1-2,11,22H,3-10H2,(H,18,23) |
| InChIKey | FLVAYULUAOITDC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide?
The IUPAC name of 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide (CID 87407288) is 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide.
What is the SMILES notation for 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide?
The canonical SMILES for 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide is O=Cc1c(O)ccc2oc(CCC(=O)NCCN3CCOCC3)nc12.
What is the InChIKey of 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide?
The InChIKey is FLVAYULUAOITDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O5/c21-11-12-13(22)1-2-14-17(12)19-16(25-14)4-3-15(23)18-5-6-20-7-9-24-10-8-20/h1-2,11,22H,3-10H2,(H,18,23).
What are the key properties of 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide?
3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide has a molecular weight of 347.37 g/mol, XLogP of 0.73, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-formyl-5-hydroxy-1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide is sourced from PubChem (CID 87407288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).