sodium (diethylhydrazinylidene)azanide

C4H10N3Na — CID 87407533

IUPACsodium (diethylhydrazinylidene)azanide
SMILESCCN(CC)N=[N-].[Na+]
InChIInChI=1S/C4H10N3.Na/c1-3-7(4-2)6-5;/h3-4H2,1-2H3;/q-1;+1
InChIKeyZJLUCJHJTPNQOD-UHFFFAOYSA-N
MW123.13 g/mol
LogP-1.73
Rot. Bonds3

About sodium (diethylhydrazinylidene)azanide

sodium (diethylhydrazinylidene)azanide (PubChem CID 87407533) has the molecular formula C4H10N3Na and a molecular weight of 123.13 g/mol. Its IUPAC name is sodium (diethylhydrazinylidene)azanide.

Molecular Properties

Compound Namesodium (diethylhydrazinylidene)azanide
PubChem CID87407533
Molecular FormulaC4H10N3Na
Molecular Weight123.13 g/mol
Exact Mass123.08
IUPAC Namesodium (diethylhydrazinylidene)azanide
SMILESCCN(CC)N=[N-].[Na+]
InChIInChI=1S/C4H10N3.Na/c1-3-7(4-2)6-5;/h3-4H2,1-2H3;/q-1;+1
InChIKeyZJLUCJHJTPNQOD-UHFFFAOYSA-N
XLogP-1.73
TPSA37.90 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500123.13
LogP ≤ 5-1.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze sodium (diethylhydrazinylidene)azanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium (diethylhydrazinylidene)azanide?
The IUPAC name of sodium (diethylhydrazinylidene)azanide (CID 87407533) is sodium (diethylhydrazinylidene)azanide.
What is the SMILES notation for sodium (diethylhydrazinylidene)azanide?
The canonical SMILES for sodium (diethylhydrazinylidene)azanide is CCN(CC)N=[N-].[Na+].
What is the InChIKey of sodium (diethylhydrazinylidene)azanide?
The InChIKey is ZJLUCJHJTPNQOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N3.Na/c1-3-7(4-2)6-5;/h3-4H2,1-2H3;/q-1;+1.
What are the key properties of sodium (diethylhydrazinylidene)azanide?
sodium (diethylhydrazinylidene)azanide has a molecular weight of 123.13 g/mol, XLogP of -1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (diethylhydrazinylidene)azanide is sourced from PubChem (CID 87407533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).