C10H14N2 — CID 87407568
2,2-diisocyano-1,1,3,3-tetramethylcyclobutane (PubChem CID 87407568) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,2-diisocyano-1,1,3,3-tetramethylcyclobutane.
| Compound Name | 2,2-diisocyano-1,1,3,3-tetramethylcyclobutane |
|---|---|
| PubChem CID | 87407568 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,2-diisocyano-1,1,3,3-tetramethylcyclobutane |
| SMILES | [C-]#[N+]C1([N+]#[C-])C(C)(C)CC1(C)C |
| InChI | InChI=1S/C10H14N2/c1-8(2)7-9(3,4)10(8,11-5)12-6/h7H2,1-4H3 |
| InChIKey | CZHOFLBJHCCVNE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|