About [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid
[4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid (PubChem CID 87407603) has the molecular formula C14H22O6S
and a molecular weight of 318.39 g/mol. Its IUPAC name is [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid.
Molecular Properties
| Compound Name | [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| PubChem CID | 87407603 |
| Molecular Formula | C14H22O6S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| SMILES | C=COC(C)OC12CCC(CS(=O)(=O)O)(C(=O)C1)C2(C)C |
| InChI | InChI=1S/C14H22O6S/c1-5-19-10(2)20-14-7-6-13(11(15)8-14,12(14,3)4)9-21(16,17)18/h5,10H,1,6-9H2,2-4H3,(H,16,17,18) |
| InChIKey | HOQHIDQWVCDZKD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid?
The IUPAC name of [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid (CID 87407603) is [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid.
What is the SMILES notation for [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid?
The canonical SMILES for [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid is C=COC(C)OC12CCC(CS(=O)(=O)O)(C(=O)C1)C2(C)C.
What is the InChIKey of [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid?
The InChIKey is HOQHIDQWVCDZKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O6S/c1-5-19-10(2)20-14-7-6-13(11(15)8-14,12(14,3)4)9-21(16,17)18/h5,10H,1,6-9H2,2-4H3,(H,16,17,18).
What are the key properties of [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid?
[4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid has a molecular weight of 318.39 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-ethenoxyethoxy)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid is sourced from PubChem (CID 87407603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).