C12H8O — CID 87407906
10-oxatetracyclo[6.5.0.02,7.09,11]trideca-1,3,5,7,12-pentaene (PubChem CID 87407906) has the molecular formula C12H8O and a molecular weight of 168.19 g/mol. Its IUPAC name is 10-oxatetracyclo[6.5.0.02,7.09,11]trideca-1,3,5,7,12-pentaene.
| Compound Name | 10-oxatetracyclo[6.5.0.02,7.09,11]trideca-1,3,5,7,12-pentaene |
|---|---|
| PubChem CID | 87407906 |
| Molecular Formula | C12H8O |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 10-oxatetracyclo[6.5.0.02,7.09,11]trideca-1,3,5,7,12-pentaene |
| SMILES | C1=CC2OC2C2=c3ccccc3=C12 |
| InChI | InChI=1S/C12H8O/c1-2-4-8-7(3-1)9-5-6-10-12(13-10)11(8)9/h1-6,10,12H |
| InChIKey | GRZXREUFTYRRJH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|