C21H21F4NO5S — CID 87408123
[(6aR)-6-ethyl-2-(2-fluoroethoxy)-11-hydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] trifluoromethanesulfonate (PubChem CID 87408123) has the molecular formula C21H21F4NO5S and a molecular weight of 475.46 g/mol. Its IUPAC name is [(6aR)-6-ethyl-2-(2-fluoroethoxy)-11-hydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] trifluoromethanesulfonate.
| Compound Name | [(6aR)-6-ethyl-2-(2-fluoroethoxy)-11-hydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87408123 |
| Molecular Formula | C21H21F4NO5S |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | [(6aR)-6-ethyl-2-(2-fluoroethoxy)-11-hydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] trifluoromethanesulfonate |
| SMILES | CCN1CCc2cc(OCCF)cc3c2[C@H]1Cc1ccc(OS(=O)(=O)C(F)(F)F)c(O)c1-3 |
| InChI | InChI=1S/C21H21F4NO5S/c1-2-26-7-5-13-9-14(30-8-6-22)11-15-18(13)16(26)10-12-3-4-17(20(27)19(12)15)31-32(28,29)21(23,24)25/h3-4,9,11,16,27H,2,5-8,10H2,1H3/t16-/m1/s1 |
| InChIKey | BAJUBFQOYNPREP-MRXNPFEDSA-N |
| XLogP | 4.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|