About N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide
N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide (PubChem CID 87408321) has the molecular formula C18H17N5O2S
and a molecular weight of 367.43 g/mol. Its IUPAC name is N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide |
| PubChem CID | 87408321 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(CNC(=O)Nc2nc(-c3ccncc3)cs2)c1 |
| InChI | InChI=1S/C18H17N5O2S/c1-12(24)21-15-4-2-3-13(9-15)10-20-17(25)23-18-22-16(11-26-18)14-5-7-19-8-6-14/h2-9,11H,10H2,1H3,(H,21,24)(H2,20,22,23,25) |
| InChIKey | SEBIPHAOUSNXEJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide?
The IUPAC name of N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide (CID 87408321) is N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide.
What is the SMILES notation for N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide?
The canonical SMILES for N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide is CC(=O)Nc1cccc(CNC(=O)Nc2nc(-c3ccncc3)cs2)c1.
What is the InChIKey of N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide?
The InChIKey is SEBIPHAOUSNXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O2S/c1-12(24)21-15-4-2-3-13(9-15)10-20-17(25)23-18-22-16(11-26-18)14-5-7-19-8-6-14/h2-9,11H,10H2,1H3,(H,21,24)(H2,20,22,23,25).
What are the key properties of N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide?
N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide has a molecular weight of 367.43 g/mol, XLogP of 3.49, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[(4-pyridin-4-yl-1,3-thiazol-2-yl)carbamoylamino]methyl]phenyl]acetamide is sourced from PubChem (CID 87408321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).