About 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione
7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione (PubChem CID 87408696) has the molecular formula C22H22N4O2
and a molecular weight of 374.44 g/mol. Its IUPAC name is 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione.
Molecular Properties
| Compound Name | 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione |
| PubChem CID | 87408696 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCC(C)c3ccccc3)c2cc1C |
| InChI | InChI=1S/C22H22N4O2/c1-13(16-7-5-4-6-8-16)9-10-26-18-12-15(3)14(2)11-17(18)23-19-20(26)24-22(28)25-21(19)27/h4-8,11-13H,9-10H2,1-3H3,(H,25,27,28) |
| InChIKey | GYKTYFROHOCMOO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione?
The IUPAC name of 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione (CID 87408696) is 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione.
What is the SMILES notation for 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione?
The canonical SMILES for 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione is Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCC(C)c3ccccc3)c2cc1C.
What is the InChIKey of 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione?
The InChIKey is GYKTYFROHOCMOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O2/c1-13(16-7-5-4-6-8-16)9-10-26-18-12-15(3)14(2)11-17(18)23-19-20(26)24-22(28)25-21(19)27/h4-8,11-13H,9-10H2,1-3H3,(H,25,27,28).
What are the key properties of 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione?
7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione has a molecular weight of 374.44 g/mol, XLogP of 3.40, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethyl-10-(3-phenylbutyl)benzo[g]pteridine-2,4-dione is sourced from PubChem (CID 87408696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).