C20H17Cl2F3N4O2 — CID 87408786
2,6-dichloro-4-(3-piperazin-1-ylphenyl)quinazoline;2,2,2-trifluoroacetic acid (PubChem CID 87408786) has the molecular formula C20H17Cl2F3N4O2 and a molecular weight of 473.28 g/mol. Its IUPAC name is 2,6-dichloro-4-(3-piperazin-1-ylphenyl)quinazoline;2,2,2-trifluoroacetic acid.
| Compound Name | 2,6-dichloro-4-(3-piperazin-1-ylphenyl)quinazoline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87408786 |
| Molecular Formula | C20H17Cl2F3N4O2 |
| Molecular Weight | 473.28 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 2,6-dichloro-4-(3-piperazin-1-ylphenyl)quinazoline;2,2,2-trifluoroacetic acid |
| SMILES | Clc1ccc2nc(Cl)nc(-c3cccc(N4CCNCC4)c3)c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H16Cl2N4.C2HF3O2/c19-13-4-5-16-15(11-13)17(23-18(20)22-16)12-2-1-3-14(10-12)24-8-6-21-7-9-24;3-2(4,5)1(6)7/h1-5,10-11,21H,6-9H2;(H,6,7) |
| InChIKey | ZBUPRVZLCSOTJJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |