C18H38F4O6Si2 — CID 87408854
triethoxy-(3,3,4,4-tetrafluoro-6-triethoxysilylhexyl)silane (PubChem CID 87408854) has the molecular formula C18H38F4O6Si2 and a molecular weight of 482.66 g/mol. Its IUPAC name is triethoxy-(3,3,4,4-tetrafluoro-6-triethoxysilylhexyl)silane.
| Compound Name | triethoxy-(3,3,4,4-tetrafluoro-6-triethoxysilylhexyl)silane |
|---|---|
| PubChem CID | 87408854 |
| Molecular Formula | C18H38F4O6Si2 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | triethoxy-(3,3,4,4-tetrafluoro-6-triethoxysilylhexyl)silane |
| SMILES | CCO[Si](CCC(F)(F)C(F)(F)CC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C18H38F4O6Si2/c1-7-23-29(24-8-2,25-9-3)15-13-17(19,20)18(21,22)14-16-30(26-10-4,27-11-5)28-12-6/h7-16H2,1-6H3 |
| InChIKey | CLNINTYKLBFSMM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|