C30H30F10NO6S3+ — CID 87408869
1-[(2-methyl-1-adamantyl)-(2-phenylsulfanylphenoxy)methoxy]ethylidene-bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanium (PubChem CID 87408869) has the molecular formula C30H30F10NO6S3+ and a molecular weight of 786.75 g/mol. Its IUPAC name is 1-[(2-methyl-1-adamantyl)-(2-phenylsulfanylphenoxy)methoxy]ethylidene-bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanium.
| Compound Name | 1-[(2-methyl-1-adamantyl)-(2-phenylsulfanylphenoxy)methoxy]ethylidene-bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanium |
|---|---|
| PubChem CID | 87408869 |
| Molecular Formula | C30H30F10NO6S3+ |
| Molecular Weight | 786.75 g/mol |
| Exact Mass | 786.11 |
| IUPAC Name | 1-[(2-methyl-1-adamantyl)-(2-phenylsulfanylphenoxy)methoxy]ethylidene-bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanium |
| SMILES | CC(OC(Oc1ccccc1Sc1ccccc1)C12CC3CC(CC(C3)C1C)C2)=[N+](S(=O)(=O)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H30F10NO6S3/c1-17-21-13-19-12-20(14-21)16-26(17,15-19)25(47-23-10-6-7-11-24(23)48-22-8-4-3-5-9-22)46-18(2)41(49(42,43)29(37,38)27(31,32)33)50(44,45)30(39,40)28(34,35)36/h3-11,17,19-21,25H,12-16H2,1-2H3/q+1 |
| InChIKey | FACBTCDPGSVLIU-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.75 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|