C32H30F14NO6S3+ — CID 87408902
bis(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-[1-[(2-methyl-1-adamantyl)-(2-phenylsulfanylphenoxy)methoxy]ethylidene]azanium (PubChem CID 87408902) has the molecular formula C32H30F14NO6S3+ and a molecular weight of 886.77 g/mol. Its IUPAC name is bis(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-[1-[(2-methyl-1-adamantyl)-(2-phenylsulfanylphenoxy)methoxy]ethylidene]azanium.
| Compound Name | bis(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-[1-[(2-methyl-1-adamantyl)-(2-phenylsulfanylphenoxy)methoxy]ethylidene]azanium |
|---|---|
| PubChem CID | 87408902 |
| Molecular Formula | C32H30F14NO6S3+ |
| Molecular Weight | 886.77 g/mol |
| Exact Mass | 886.10 |
| IUPAC Name | bis(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-[1-[(2-methyl-1-adamantyl)-(2-phenylsulfanylphenoxy)methoxy]ethylidene]azanium |
| SMILES | CC(OC(Oc1ccccc1Sc1ccccc1)C12CC3CC(CC(C3)C1C)C2)=[N+](S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H30F14NO6S3/c1-17-21-13-19-12-20(14-21)16-26(17,15-19)25(53-23-10-6-7-11-24(23)54-22-8-4-3-5-9-22)52-18(2)47(55(48,49)31(43,44)27(33,34)29(37,38)39)56(50,51)32(45,46)28(35,36)30(40,41)42/h3-11,17,19-21,25H,12-16H2,1-2H3/q+1 |
| InChIKey | WRXPGSVYSBDMMF-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.77 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|