C20H38F8O6Si2 — CID 87409320
triethoxy-(3,3,4,4,5,5,6,6-octafluoro-8-triethoxysilyloctyl)silane (PubChem CID 87409320) has the molecular formula C20H38F8O6Si2 and a molecular weight of 582.67 g/mol. Its IUPAC name is triethoxy-(3,3,4,4,5,5,6,6-octafluoro-8-triethoxysilyloctyl)silane.
| Compound Name | triethoxy-(3,3,4,4,5,5,6,6-octafluoro-8-triethoxysilyloctyl)silane |
|---|---|
| PubChem CID | 87409320 |
| Molecular Formula | C20H38F8O6Si2 |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | triethoxy-(3,3,4,4,5,5,6,6-octafluoro-8-triethoxysilyloctyl)silane |
| SMILES | CCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C20H38F8O6Si2/c1-7-29-35(30-8-2,31-9-3)15-13-17(21,22)19(25,26)20(27,28)18(23,24)14-16-36(32-10-4,33-11-5)34-12-6/h7-16H2,1-6H3 |
| InChIKey | MMMQZXPEPFDRCR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|